CAS No. 175923-07-6
Tris[N-N-bis(trimethylsilyl)amide]lanthanum(III)
For more details check the specification page:
Chemical identifiers
Linear formula | La(N[Si(CH3)3]2)3 |
Pubchem CID | 4177234 |
IUPAC Name | bis(trimethylsilyl) azanide; lanthanum(3+) |
SMILES | C[Si](C)(C)N([La](N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
InchI Identifier | InChI=1S/3C6H18NSi2.La/c3*1-8(2,3)7-9(4,5)6;/h3*1-6H3;/q3*-1;+3 |
InchI Key | ZDYNTRMQDURVDM-UHFFFAOYSA-N |
Safety information
UN | 3396 |
Hazardous class | 4.3 (4.1) |
Packing group | II |
Pictograms | ![]() ![]() |
Signal word | DANGER |
Hazard statements | H228-H261-H314-H318 |
Precautionary statements | P210-P223-P231 + P232-P240-P241-P260-P264-P280-P301 + P330 + P331-P303 + P361 + P353-P304 + P340-P305 + P351 + P338-P310-P334 + P335-P363-P370 + P378 |
Transport description | Organometallic substance, solid, water- reactive, flammable (Tris[N-N- bis(trimethylsilyl)amide] Lanthanum(III)) |
In TSCA registry | No (sold for research and development usage only) |