CAS Number 177099-51-3
For more details check the specification page: Bis(N,N-di-tert-butyl-1,4-diaza-1,3-butadienyl)cobalt
Chemical identifiers
| Linear formula | C20H42N4Co |
| Pubchem CID | 131698366 |
| SMILES | CC(C)(C)N=CC=NC(C)(C)C.CC(C)(C)N=CC=NC(C)(C)C.[Co] |
| IUPAC Name | cobalt;N,N'-ditert-butylethane-1,2-diimine |
| InchI Identifier | InChI=1S/2C10H20N2.Co/c2*1-9(2,3)11-7-8-12-10(4,5)6;/h2*7-8H,1-6H3; |
| InchI Key | CC(C)(C)N=CC=NC(C)(C)C.CC(C)(C)N=CC=NC(C)(C)C.[Co] |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H301, H315, H317, H319, H334, H341, H351, H410 |
| Precautionary statements | P203, P233, P260, P264, P265, P270, P271, P272, P273, P280, P284, P301, P302, P304, P305, P316, P317, P318, P330, P332, P337, P338, P340, P342, P351, P352, P362, P364, P391, P403, P405, P501 |
| UN | 3467 |
| Transport description | ORGANOMETALLIC COMPOUND, TOXIC, SOLID, N.O.S. (Bis(N,N-di-tertbutyl-1,4-diaza-1,3- butadienyl)cobalt) |
| Hazardous class | 6.1 |
| Packing group | III |
| In TSCA registry | No (sold for research and development usage only) |