CAS Number 133984-08-4
For more details check the specification page: Bis[bis(trimethylsilyl)amido]iron(II)
Chemical identifiers
| Linear formula | C24H72Fe2N4Si8 |
| SMILES | [N-]([Fe+2]1[N-]([Fe+2]([N-]([Si](C)(C)C)[Si](C)(C)C)[N-]1([Si](C)(C)C)[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InchI Identifier | InChI=1S/4C6H18NSi2.2Fe/c4*1-8(2,3)7-9(4,5)6;;/h4*1-6H3;;/q4*-1;2*+2 |
| InchI Key | CIVQLIRANZLOFE-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms |   |
| Hazard statements | H228, H250, H260, H314, H318 |
| Precautionary statements | P210, P222, P223, P231, P232, P233, P240, P241, P260, P264, P265, P280, P301, P302, P305, P316, P330, P331, P334, P335, P338, P354, P361, P363, P370, P378, P402, P404, P405, P501 |
| UN | 3393 |
| Transport description | ORGANOMETALLIC SUBSTANCE, SOLID, PYROPHORIC, WATER-REACTIVE (Bis[bis(trimethylsilyl)amido]iron(II)) |
| Hazardous class | 4.2(4.3) |
| Packing group | I |
| In TSCA registry | No (sold for research and development usage only) |