CAS Number 61247-57-2
For more details check the specification page: Niobium(IV) chloride tetrahydrofuran complex
Chemical identifiers
| Linear formula | NbCl4(CO4H8)2 |
| Pubchem CID | 2733349 |
| SMILES | [Nb](Cl)(Cl)(Cl)Cl.O1CCCC1.O2CCCC2 |
| IUPAC Name | oxolane; tetrachloroniobium |
| InchI Identifier | InChI=1S/2C4H8O.4ClH.Nb/c2*1-2-4-5-3-1;;;;;/h2*1-4H2;4*1H;/q;;;;;;+4/p-4 |
| InchI Key | OLGCTTOCPNLTKW-UHFFFAOYSA-J |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H228, H314, H318 |
| Precautionary statements | P210, P240, P241, P260, P264 + P265, P280, P301 + P330 + P331, P302 + P361 + P354, P304 + P340, P305 + P354 + P338, P316, P363, P370 + P378, P405, P501 |
| UN | 2925 |
| Transport description | FLAMMABLE SOLIDS, CORROSIVE, ORGANIC, N.O.S. |
| Hazardous class | 4.1(8) |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 49C |