CAS Number 6485-79-6
For more details check the specification page: Triisopropylsilane
Chemical identifiers
| Linear formula | [(CH3)2CH]3SiH |
| Pubchem CID | 6327611 |
| SMILES | [SiH](C(C)C)(C(C)C)C(C)C |
| IUPAC Name | tri(propan-2-yl)silicon |
| InchI Identifier | InChI=1S/C9H22Si/c1-7(2)10(8(3)4)9(5)6/h7-10H,1-6H3 |
| InchI Key | YDJXDYKQMRNUSA-UHFFFAOYSA-N |
Safety Information
| Signal word | WARNING |
| Pictograms | |
| UN | 1993 |
| Transport description | FLAMMABLE LIQUID, N.O.S. (SILANE, TRIS-ISOPROPYL) |
| Hazardous class | 3 |
| Packing group | III |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 38C |