CAS Number 17348-27-5
For more details check the specification page: Tantalum, tetraethoxy(hydrogen acetoacetato)-,ester
Chemical identifiers
| Linear formula | C16H39N4Ta |
| SMILES | O(C1=O[Ta+5](O=C([CH-]1)C)([O-]CC)([O-]CC)([O-]CC)[O-]CC)CC |
Safety Information
| Signal word | WARNING |
| Pictograms |   |
| Hazard statements | H228, H315, H319, H335 |
| Precautionary statements | P210, P233, P240, P241, P261, P264, P271, P280, P302, P304, P305, P312, P313, P332, P337, P338, P340, P351, P352, P362, P370, P378, P403, P405, P501 |
| UN | 1993 |
| Transport description | FLAMMABLE LIQUIDS,ORGANIC, N.O.S.(tantalum,tetraethoxy(hydrogenacetoacetato)-,ester) |
| Hazardous class | 3 |
| Packing group | III |
| In TSCA registry | No (sold for research and development usage only) |