CAS Number 123927-75-3
For more details check the specification page: Trimethoxy(pentamethylcyclopentadienyl)titanium(IV)
Chemical identifiers
| Linear formula | C13H24O3Ti |
| Pubchem CID | 10989493 |
| SMILES | C[C]1[C]([C]([C]([C]1C)C)C)C.CO[Ti](OC)OC |
| IUPAC Name | methanol; 1,2,3,4,5-pentamethylcyclopentane; titanium |
| InchI Identifier | InChI=1S/C10H15.3CH3O.Ti/c1-6-7(2)9(4)10(5)8(6)3;3*1-2;/h1-5H3;3*1H3;/q;3*-1;+3 |
| InchI Key | KYPOTCHOVIFPTJ-UHFFFAOYSA-N |
Safety Information
| Signal word | WARNING |
| Pictograms | |
| Hazard statements | H278 |
| UN | 1993 |
| Transport description | FLAMMABLE LIQUIDS, N.O.S. (Trimethoxy(pentamethylcyclopentadienyl) titanium(IV) |
| Hazardous class | 3 |
| Packing group | III |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 61C |