CAS Number 356039-89-9
For more details check the specification page: Bis[(tri-tert-butyl)cyclopentadienyl]barium THF/DME free
Chemical identifiers
| Linear formula | C34H58Ba |
| SMILES | CC(C)(C)C1=C(C(=C(C1)[Ba]C2=C(C(=C(C2)C(C)(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C)C(C)(C)C |
Safety Information
| Signal word | WARNING |
| Pictograms |  |
| Hazard statements | H315, H319, H335 |
| Precautionary statements | P261, P264 + P265, P271, P280, P302 + P352, P304 + P340, P305 + P351 + P338, P319, P332 + P317, P337 + P317, P362 + P364, P403 + P233, P405, P501 |
| UN | NOT REGULATED |
| In TSCA registry | No (sold for research and development usage only) |