CAS Number 17154-34-6
For more details check the specification page: Diphenyl(trimethylsilyl)phosphine
Chemical identifiers
| Linear formula | (C6H5)2PSi(CH3)3 |
| Pubchem CID | 140190 |
| SMILES | C[Si](C)(C)P(C1=CC=CC=C1)C2=CC=CC=C2 |
| IUPAC Name | diphenyl(trimethylsilyl)phosphane |
| InchI Identifier | InChI=1S/C15H19PSi/c1-17(2,3)16(14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InchI Key | WTWVGNUJAAOVSC-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| UN | 1993 |
| Transport description | FLAMMABLE LIQUID, N.O.S. (Diphenyl(trimethylsilyl)phosphine) (Diphenyl(trimethylsilyl)phosphine) |
| Hazardous class | 3 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 10C |