CAS Number 21154-48-3
For more details check the specification page: Germanium(IV)isopropoxide
Chemical identifiers
| Linear formula | Ge(OCH(CH3)2)4 |
| Pubchem CID | 16685043 |
| SMILES | [Ge](OC(C)C)(OC(C)C)(OC(C)C)OC(C)C |
| IUPAC Name | tetra(propan-2-yloxy)germane |
| InchI Identifier | InChI=1S/C12H28GeO4/c1-9(2)14-13(15-10(3)4,16-11(5)6)17-12(7)8/h9-12H,1-8H3 |
| InchI Key | PKLMYPSYVKAPOX-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms |   |
| UN | 2920 |
| Transport description | CORROSIVE LIQUID, FLAMMABLE, N.O.S. (Germanium(IV) isopropoxide) |
| Hazardous class | 8(3) |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 60C |