CAS Number 21959-01-3
For more details check the specification page: Zirconium (IV) chloride THF complex (2:1)
Chemical identifiers
| Linear formula | ZrCl4 · 2OC4H8 |
| Pubchem CID | 2734040 |
| SMILES | C1CCOC1.C1CCOC1.Cl[Zr](Cl)(Cl)Cl |
| IUPAC Name | oxolane;tetrachlorozirconium |
| InchI Identifier | InChI=1S/2C4H8O.4ClH.Zr/c2*1-2-4-5-3-1;;;;;/h2*1-4H2;4*1H;/q;;;;;;+4/p-4 |
| InchI Key | VDJJKYYENYIHFF-UHFFFAOYSA-J |
Safety Information
| Signal word | DANGER |
| Pictograms |    |
| UN | 2925 |
| Transport description | isopropoxide |
| Hazardous class | 4.1(8) |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |