CAS Number 359847-15-7
For more details check the specification page: Niobium tetraethoxy dimethylaminoethoxide
Chemical identifiers
| Linear formula | Nb(OC2H5)4OCH2CH2N(CH)2 |
| SMILES | [O-](CC)[Nb+5]1([O-]CC)([O-]CC)([O-]CC)[O-]CC[N]1(C)C |
Safety Information
| Signal word | WARNING |
| Pictograms |  |
| Hazard statements | H303, H313, H315, H319, H332, H335 |
| Precautionary statements | P261, P264 + P265, P271, P280, P301 + P317, P302 + P317, P302 + P352, P304 + P340, P305 + P351 + P338, P319, P317, P332 + P317, P337 + P317, P362 + P364, P403 + P233, P405, P501 |
| UN | NOT REGULATED |
| In TSCA registry | No (sold for research and development usage only) |