CAS Number 39470-11-6
For more details check the specification page: Tris(methylcyclopentadienyl)gadolinium
Chemical identifiers
| Linear formula | Gd(C6H7)3 |
| SMILES | CC1=C(CC=C1)[Gd](C2=C(C)C=CC2)C3=C(C)C=CC3 |
Safety Information
| Signal word | DANGER |
| Pictograms |  |
| Hazard statements | H228, H315, H320, H335 |
| Precautionary statements | P210, P240, P241, P261, P264, P271, P280, P302 + P352, P304 + P340, P305 + P351 + P338, P319, P332 + P317, P337 + P317, P362 + P364, P370 + P378, P403 + P233, P405, P501 |
| UN | 1325 |
| Transport description | Flammable solid, organic, n.o.s. (Tris(methylcyclopenta dienyl)gadolinium |
| Hazardous class | 4.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |