CAS Number 4249-10-9
For more details check the specification page: 1,2,3,4-Tetramethyl- 1,3-cyclopentadiene, mixed isomers
Chemical identifiers
| Linear formula | C9H14 |
| Pubchem CID | 138163 |
| SMILES | CC1=C(C(=C(C1)C)C)C |
| IUPAC Name | 1,2,3,4-tetramethylcyclopenta-1,3-diene |
| InchI Identifier | InChI=1S/C9H14/c1-6-5-7(2)9(4)8(6)3/h5H2,1-4H3 |
| InchI Key | VNPQQEYMXYCAEZ-UHFFFAOYSA-N |
Safety Information
| Signal word | WARNING |
| Pictograms | |
| Hazard statements | H226 |
| Precautionary statements | P210, P233, P240, P241, P242, P243, P280, P303 + P361 + P353, P370 + P378, P403 + P235, P501 |
| UN | 3295 |
| Transport description | HYDROCARBONS, LIQUID, N.O.S. |
| Hazardous class | 3 |
| Packing group | III |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 42C |