CAS Number 82061-21-0
For more details check the specification page: Lithium tetramethylcyclopentadienide
Chemical identifiers
| Linear formula | LiC9H13 |
| Pubchem CID | 16213219 |
| SMILES | [C]1([C]([C]([CH][C]1C)C)C)C.[LiH] |
| IUPAC Name | lithium; 1,2,4,5-tetramethylcyclopenta-1,3-diene |
| InchI Identifier | InChI=1S/C9H13.Li/c1-6-5-7(2)9(4)8(6)3;/h5H,1-4H3; |
| InchI Key | HSQYLEJMIWEJBM-UHFFFAOYSA-N |
Safety Information
| Signal word | DANGER |
| Pictograms | |
| UN | 1325 |
| Transport description | FLAMMABLE SOLIDS, ORGANIC, N.O.S. |
| Hazardous class | 4.1 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |