Triphenylgermanium chloride
Synonym: Ph3GeCl, Triphenylchlorogermane, Chlorotriphenylgermane, Triphenylgermyl chloride, Germanium triphenyl chloride
Overview
Ereztech manufactures and sells this product in small and bulk volumes. Glass ampules, bottles or metal ampules or bubblers are available for packaging. For additional analytical information or details about purchasing Triphenylgermanium chloride contact us at sales@ereztech.com
| Product Code | GE6240 |
| Product Name | Triphenylgermanium chloride |
| CAS Number | 1626-24-0 |
| Molecular formula | C18H15Ge |
| Linear formula | (C6H5)3GeCl |
| Molecular weight | 339.41 |
| Form | solid |
| Melting point | 114-115C |
| Boiling point | 285C |
| Sensitivity | moisture |
Test Specification
| Assay (purity) | 99% |
| Purity method | by titration |
| Metal purity | 99%-Ge |
| Appearance | white to yellow powder, solid or crystals |
| Titration | %Ge=98.5-101.5 |
| Titration notes | with AgNO3 |
Safety Information
| Signal word | WARNING |
| Pictograms | |
| Hazard statements | H302, H312, H315, H319, H332, H335 |
| Precautionary statements | P261, P264 + P265, P270, P271, P280, P301 + P317, P302 + P352, P304 + P340, P305 + P351 + P338, P317, P319, P330, P332 + P317, P337 + P317, P362 + P364, P403 + P233, P405, P501 |
| UN | NOT REGULATED |
| In TSCA registry | Yes |
External Identifiers for Ph3GeCl
| Pubchem CID | 74197 |
| SMILES | [Ge](Cl)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| IUPAC Name | chloro(triphenyl)germane |
| InchI Identifier | InChI=1S/C18H15ClGe/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InchI Key | ONQMBYVVEVFYRP-UHFFFAOYSA-N |
| MDL Number | MFCD00000461 |
| EC Number | 216-617-5 |