For more details check the specification page: Tris(pentafluorophenyl)borane
Linear formula | (C6F5)3B |
Pubchem CID | 582056 |
SMILES | B(C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)C3=C(C(=C(C(=C3bF)F)F)F)F |
IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)borane |
InchI Identifier | InChI=1S/C18BF15/c20-4-1(5(21)11(27)16(32)10(4)26)19(2-6(22)12(28)17(33)13(29)7(2)23)3-8(24)14(30)18(34)15(31)9(3)25 |
InchI Key | OBAJXDYVZBHCGT-UHFFFAOYSA-N |
UN | 2811 |
Hazardous class | 6.1 |
Packing group | III |
Pictograms | |
Signal word | DANGER |
Hazard statements | H301-H315-H319-H335-H400-H410 |
Precautionary statements | P261-P264-P270-P271-P273-P280 |
Transport description | TOXIC SOLID, ORGANIC, N.O.S. Tris(pentaflourophenyl) borane |
In TSCA registry | No (sold for research and development usage only) |