For more details check the specification page: Bis(ethylcyclopentadienyl)magnesium
| Linear formula | Mg(C5H4C2H5)2 |
| Pubchem CID | 22336304 |
| SMILES | CCC1=[C-]CC=C1.CCC1=[C-]CC=C1.[Mg+2] |
| IUPAC Name | magnesium; 2-ethylcyclopenta-1,3-diene |
| InchI Identifier | InChI=1S/2C7H9.Mg/c2*1-2-7-5-3-4-6-7;/h2*3,5H,2,4H2,1H3;/q2*-1;+2 |
| InchI Key | UBRLRTCDAHALGT-UHFFFAOYSA-N |
| UN | 3394 |
| Hazardous class | 4.2 (4.3) |
| Packing group | I |
| Pictograms | |
| Signal word | DANGER |
| Hazard statements | |
| Precautionary statements | P210-P222-P223-P231 + P232-P233-P240-P241-P342-P243-P260-P261-P271-P280-P301 + P330 + P331-P303 + P361 + P353-P304 + P340-P305 + P351 + P338-P310-P334 + P335-P363-P370 + P378 |
| Transport description | Organometallic substance, liquid, pyrophoric, water-reactive (Bis(ethylcyclopentadienyl)magnesium) |
| In TSCA registry | No (for research and development only) |