For more details check the specification page: Cobalt, tricarbonyl(h3-2-propenyl)
| Linear formula | (C3H6)Co(C0)3 |
| Pubchem CID | 135094398 |
| SMILES | C1C2C[Co]12(C#[OH])(C#[OH])C#[OH] |
| InchI Identifier | InChI=1S/C3H5.3CHO.Co/c1-3-2;3*1-2;/h3H,1-2H2;3*2H; |
| InchI Key | VWEYORAUTMIOLH-UHFFFAOYSA-N |
| UN | 1992 |
| Hazardous class | 3 (6.1) |
| Packing group | III |
| Pictograms | |
| Signal word | DANGER |
| Hazard statements | H226-H301-H311-H317-H331-H334-H341-H351-H413 |
| Precautionary statements | P201-P202-P210-P233-P240-P241-P242-P243-P261-P264-P270-P271-P272-P273-P280-P285-P301 + P310-P302 + P352-P303 + P361 + P353-P304 + P340-P308 + P313-P311-P333 + P313-P342 + P311-P363-P370 + P378 |
| Transport description | Flammable liquid, toxic, n.o.s. (Cobalt, tricarbonyl(h3-2- propenyl)) |
| In TSCA registry | No (research and development usage only) |