For more details check the specification page: Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)manganese(III)
Linear formula | Mn(C11H19O2)3 |
Pubchem CID | 11456218 |
IUPAC Name | (Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;manganese |
SMILES | CC(C)(C)C(=CC(=O)C(C)(C)C)O[Mn](OC(=CC(=O)C(C)(C)C)C(C)(C)C)OC(=CC(=O)C(C)(C)C)C(C)(C)C |
InchI Identifier | InChI=1S/3C11H20O2.Mn/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-; |
InchI Key | ORZPLLPBZHORSD-LWTKGLMZSA-K |
UN | Not regulated |
Hazardous class | Not regulated |
Packing group | Not regulated |
Pictograms | |
Signal word | WARNING |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P264-P271-P280-P302 + P352-P304 + P340-P305 + P351 + P338-P332 + P313-P337 + P313-P362-P403 + P233-P405 |
Transport description | NONH for all modes of transport |
In TSCA registry | No (research and development usage only) |