For more details check the specification page: Bromopentacarbonylmanganese(I)
Linear formula | BrMn(CO)5 |
Pubchem CID | 10978692 |
IUPAC Name | bromo-pentakis(oxomethyl)manganese |
SMILES | [C](=O)[Mn]([C]=O)([C]=O)([C]=O)([C]=O)Br |
InchI Identifier | InChI=1S/5CO.BrH.Mn/c5*1-2;;/h;;;;;1H;/q;;;;;;+1/p-1 |
InchI Key | OESORJHGSXJTKX-UHFFFAOYSA-M |
UN | Not regulated |
Hazardous class | Not regulated |
Packing group | Not regulated |
Pictograms | |
Signal word | WARNING |
Hazard statements | H302 + H312 + H332 |
Precautionary statements | P261-P264-P271-P280P301 + P312-P302 + P352-P304 + P340-P312-P322-P330-P363 |
Transport description | NONH for all modes of transport |
In TSCA registry | No (research and development usage only) |