For more details check the specification page: 1,3-Bis(di-tert-butylphosphinomethyl)benzene
Linear formula | C6H4[CH2P[C(CH3)]2]2 |
Pubchem CID | 4188717 |
IUPAC Name | ditert-butyl-[[3-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane |
SMILES | CC(C)(C)P(CC1=CC(=CC=C1)CP(C(C)(C)C)C(C)(C)C)C(C)(C)C |
InchI Identifier | InChI=1S/C24H44P2/c1-21(2,3)25(22(4,5)6)17-19-14-13-15-20(16-19)18-26(23(7,8)9)24(10,11)12/h13-16H,17-18H2,1-12H3 |
InchI Key | VNLHPVUKSKTUPA-UHFFFAOYSA-N |
UN | Not regulated |
Hazardous class | Not regulated |
Packing group | Not regulated |
Pictograms | |
Signal word | WARNING |
Hazard statements | H302-H315-H319-H335 |
Precautionary statements | P261-P264-P271-P280-P301 + P312-P302 = P352-P304 + P340-P305 + P351 + P338-P332 + P313-P337 + P313-P362 |
Transport description | NONH for all modes of transport |
In TSCA registry | No (research and development usage only) |