For more details check the specification page: Bis[bis(trimethylsilyl)amino]germanium
Linear formula | C12H36GeN2Si4 |
Pubchem CID | 50931156 |
SMILES | C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.[Ge] |
IUPAC Name | bis(trimethylsilyl)azanide;germanium |
InchI Identifier | InChI=1S/2C6H18NSi2.Ge/c2*1-8(2,3)7-9(4,5)6;/h2*1-6H3;/q2*-1; |
InchI Key | BENXECSQAZXGRT-UHFFFAOYSA-N |
UN | Not regulated |
Hazardous class | Not regulated |
Packing group | Not regulated |
Pictograms | |
Signal word | WARNING |
Hazard statements | H302-H315-H319-H332-H335 |
Precautionary statements | P264-P264-P271-P280-P301 + P312-P303 + P361 + P353-P304 + P340-P305 + P351 + P338-p312-P3030-P332 + P313-P337 + P313-P362-P370 + P378 |
Transport description | NONH for all modes of transport |