For more details check the specification page: Bis(ethylcyclopentadienyl)cobalt
| Linear formula | (C2H5C5H4)2Co |
| Pubchem CID | 90473521 |
| IUPAC Name | cobalt;ethylcyclopentane |
| SMILES | CC[C]1[CH][CH][CH][CH]1.CC[C]1[CH][CH][CH][CH]1.[Co] |
| InchI Identifier | InChI=1S/2C7H9.Co/c2*1-2-7-5-3-4-6-7;/h2*3-6H,2H2,1H3; |
| InchI Key | YHCQFTZSIGZRTR-UHFFFAOYSA-N |
| UN | Not regulated |
| Hazardous class | Not regulated |
| Packing group | Not regulated |
| Pictograms | N/A |
| Signal word | N/A |
| Hazard statements | Not a hazardous substance or mixture |
| Precautionary statements | Not a hazardous substance or mixture |
| Transport description | NONH for all modes of transport |
| In TSCA registry | No (research and development usage only) |