For more details check the specification page: Tin(II) acetate
| Linear formula | Sn(CH3CO2)2 |
| Pubchem CID | 69488 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Sn+2] |
| IUPAC Name | Stannic Tetraacetate |
| InchI Identifier | InChI=1S/2C2H4O2.Sn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InchI Key | PNOXNTGLSKTMQO-UHFFFAOYSA-L |
| UN | 3146 |
| Hazardous class | 6.1 |
| Packing group | III |
| Pictograms | |
| Signal word | WARNING |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P280 |
| Transport description | Organotin compound, solid, n.o.s. (Tin di (acetate)) |
| In TSCA registry | No (sold for research and development usage only) |