For more details check the specification page: Sodium isopropylcyclopentadienide
| Linear formula | (C3H7C5H4)Na |
| Pubchem CID | 16213221 |
| IUPAC Name | sodium;5-propan-2-ylcyclopenta-1,3-diene |
| SMILES | CC(C)[C-]1C=CC=C1.[Na+] |
| InchI Identifier | InChI=1S/C8H11.Na/c1-7(2)8-5-3-4-6-8;/h3-7H,1-2H3;/q-1;+1 |
| InchI Key | IWYSOVJPHUTFIM-UHFFFAOYSA-N |
| UN | 1325 |
| Hazardous class | 4.1 |
| Packing group | II |
| Pictograms | |
| Signal word | DANGER |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P240-P241-P261-P264-P271-P280-P302 + P352-P304 + P340-P305 + P351 + P338-P312-P332 + P313-P337 + P313-P362-P370 + P378 |
| Transport description | Flammable solid, organic, n.o.s. (sodium isopropyl- cyclopentadienide) |
| In TSCA registry | No (research and development usage only) |