For more details check the specification page: [Dimethylbis(cyclopentadienyl)silyl]zirconium dichloride
| Linear formula | [(CH3)2Si(C5H4)2]ZrCl2 |
| Pubchem CID | 90476866 |
| IUPAC Name | dichlorozirconium;di(cyclopentyl)-dimethylsilane |
| SMILES | C[Si](C)([C]1[CH][CH][CH][CH]1)[C]2[CH][CH][CH][CH]2.Cl[Zr]Cl |
| InchI Identifier | InChI=1S/C12H14Si.2ClH.Zr/c1-13(2,11-7-3-4-8-11)12-9-5-6-10-12;;;/h3-10H,1-2H3;2*1H;/q;;;+2/p-2 |
| InchI Key | RZDGOAAQKUSJSU-UHFFFAOYSA-L |
| UN | Not regulated |
| Hazardous class | Not regulated |
| Packing group | Not regulated |
| Pictograms | |
| Signal word | WARNING |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302 + P352-P304 + P340-P305 + P351 + P338-P312-P332 + P313-P362 |
| Transport description | NONH for all modes of transport |
| In TSCA registry | No (research and development usage only) |