CAS Number 122676-67-9
For more details check the specification page: Bis[bis(trimethylsilyl)amido]manganese(II)
Chemical identifiers
| Linear formula | Mn(C6H18NSi2)2 |
| Pubchem CID | 15794010 |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.C[Si](C)(C)[N-][Si](C)(C)C.[Mn+2] |
| IUPAC Name | bis(trimethylsilyl)azanide; manganese(2+) |
| InchI Identifier | InChI=1S/2C6H18NSi2.Mn/c2*1-8(2,3)7-9(4,5)6;/h2*1-6H3;/q2*-1;+2 |
| InchI Key | XKPPYOULOBQXPV-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H261, H314, H335 |
| Precautionary statements | P223, P231+P232, P260, P261, P264, P271, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P312, P321, P335+P334, P363, P370+P378, P402+P404, P403+P233, P405, P501 |
| UN | 3131 |
| Transport description | WATER-REACTIVE SOLID, CORROSIVE, N.O.S. |
| Hazardous class | 4.3(8) |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |

