CAS Number 13154-25-1
  For more details check the specification page: Triisobutylchlorosilane
Chemical identifiers
| Linear formula | [(CH3)2CHCH2]3SiCl | 
| Pubchem CID | 350907 | 
| SMILES | Cl[Si](CC(C)C)(CC(C)C)CC(C)C | 
| IUPAC Name | chloro-tris(2-methylpropyl)silane | 
| InchI Identifier | InChI=1S/C12H27ClSi/c1-10(2)7-14(13,8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3 | 
| InchI Key | TZPZCTBZJKZFGY-UHFFFAOYSA-N | 
Safety information
| Signal word | DANGER | 
| Pictograms | |
| Hazard statements | H227, H314 | 
| Precautionary statements | P210, P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P370+P378, P403+P235, P405, P501 | 
| UN | 2987 | 
| Transport description | CHLOROSILANES, CORROSIVE, N.O.S. | 
| Hazardous class | 8 | 
| Packing group | II | 
| In TSCA registry | No (sold for research and development usage only) | 
| Flash point | 87C | 

 
  
 