CAS Number 1011514-41-2
For more details check the specification page: Bis(ethylmethylamino)silane
Chemical identifiers
| Linear formula | SiN2C6H18 |
| Pubchem CID | 102392301 |
| SMILES | CCN(C)[SiH2]N(C)CC |
| IUPAC Name | N-[ethyl(methyl)amino]silyl-N-methylethanamine |
| InchI Identifier | InChI=1S/C6H18N2Si/c1-5-7(3)9-8(4)6-2/h5-6,9H2,1-4H3 |
| InchI Key | RTCWKUOBAKIBGZ-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H225, H261, H302, H314, H318, H335 |
| Precautionary statements | P210, P223, P231+P232, P233, P240, P241, P242, P243, P260, P264 + P265, P270, P271, P280, P301 + P317, P301 + P330 + P331, P302 + P335 + P334, P302 + P361 + P354, P304 + P340, P305 + P354 + P338, P316, P319, P330, P363, P370 + P378, P402 + P404, P403 + P233 + P235, P405, P501 |
| UN | 2924 |
| Transport description | FLAMMABLE LIQUID, CORROSIVE, N.O.S. (bis(ethylmethylamino)silane) |
| Hazardous class | 3(8) |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |

