CAS Number 3348-44-5
For more details check the specification page: Bis(dimethylamino)chlorophosphine
Chemical identifiers
| Linear formula | C4H12ClN2P |
| Pubchem CID | 76872 |
| SMILES | CN(C)P(N(C)C)Cl |
| IUPAC Name | N-[chloro(dimethylamino)phosphanyl]-N-methylmethanamine |
| InchI Identifier | InChI=1S/C4H12ClN2P/c1-6(2)8(5)7(3)4/h1-4H3 |
| InchI Key | MAJFLEHNBOUSIY-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H227, H314 |
| Precautionary statements | P210, P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P370+P378, P403+P235, P405, P501 |
| UN | 3265 |
| Transport description | CORROSIVE LIQUID, ACIDIC, ORGANIC, N.O.S |
| Hazardous class | 8 |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 76.7C |

