CAS Number 177099-51-3
  For more details check the specification page: Bis(N,N-di-tert-butyl-1,4-diaza-1,3-butadienyl)cobalt
Chemical identifiers
| Linear formula | C20H42N4Co | 
| Pubchem CID | 131698366 | 
| SMILES | CC(C)(C)N=CC=NC(C)(C)C.CC(C)(C)N=CC=NC(C)(C)C.[Co] | 
| IUPAC Name | cobalt;N,N'-ditert-butylethane-1,2-diimine | 
| InchI Identifier | InChI=1S/2C10H20N2.Co/c2*1-9(2,3)11-7-8-12-10(4,5)6;/h2*7-8H,1-6H3; | 
| InchI Key | CC(C)(C)N=CC=NC(C)(C)C.CC(C)(C)N=CC=NC(C)(C)C.[Co] | 
Safety information
| Signal word | DANGER | 
| Pictograms | |
| Hazard statements | H301, H315, H317, H319, H334, H341, H351, H410 | 
| Precautionary statements | P201, P202, P261, P264, P270, P272, P273, P280, P281, P285, P301+P310, P302+P352, P304+P341, P305+P351+P338, P308+P313, P321, P330, P332+P313, P333+P313, P337+P313, P342+P311, P362, P363, P391, P405, P501 | 
| UN | 3467 | 
| Transport description | ORGANOMETALLIC COMPOUND, TOXIC, SOLID, N.O.S. (Bis(N,N-di-tertbutyl-1,4-diaza-1,3- butadienyl)cobalt) | 
| Hazardous class | 6.1 | 
| Packing group | III | 
| In TSCA registry | No (sold for research and development usage only) | 

 
  
 