CAS Number 125542-03-2
For more details check the specification page: Chlorodimethyl(2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl)silane
Chemical identifiers
| Linear formula | C11H19SiCl |
| Pubchem CID | 5045335 |
| SMILES | CC1=C(C(=C(C1[Si](C)(C)Cl)C)C)C |
| IUPAC Name | chloro-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| InchI Identifier | InChI=1S/C11H19ClSi/c1-7-8(2)10(4)11(9(7)3)13(5,6)12/h11H,1-6H3 |
| InchI Key | QTMBNCMQGRJAAA-UHFFFAOYSA-N |
Safety information
| Signal word | DANGER |
| Pictograms | |
| Hazard statements | H226, H318 |
| Precautionary statements | P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P305+P351+P338, P310, P370+P378, P403+P235, P501 |
| UN | 2986 |
| Transport description | CHLOROSILANES, CORROSIVE, FLAMMABLE, N.O.S. |
| Hazardous class | 8(3) |
| Packing group | II |
| In TSCA registry | No (sold for research and development usage only) |
| Flash point | 56C |

