CAS No. 112379-49-4
For more details check the specification page: Bis(pentametylcyclopentadienyl)barium
Chemical identifiers
| Linear formula | BaC20H30 |
| Pubchem CID | 92043188 |
| SMILES | CC1=C([C](C(=C1C)C)C)C.CC1=C([C](C(=C1C)C)C)C.[Ba] |
| IUPAC Name | barium; 1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| InchI Identifier | InChI=1S/2C10H15.Ba/c2*1-6-7(2)9(4)10(5)8(6)3;/h2*1-5H3; |
| InchI Key | QUJWBBABMDGOEA-UHFFFAOYSA-N |
Safety information
| UN | 1564 |
| Hazardous class | 6.1 |
| Packing group | III |
| Pictograms |  |
| Signal word | WARNING |
| Hazard statements | H302-H315-H320-H335 |
| Precautionary statements | P231-P222 |
| Transport description | BARIUM COMPOUNDS, N.O.S (Bis (pentamethyl-η5-cyclopentadienyl) barium(II)) |
| In TSCA registry | No (sold for research and development usage only) |
