CAS No. 12128-26-6
Cyclopentadienyltungsten(II) tricarbonyl hydride
For more details check the specification page:
Chemical identifiers
Linear formula | C8H6O3W |
Pubchem CID | 59211708 |
IUPAC Name | 3a,4,7,7a-tetrahydro-2-benzofuran-4,7-diide-1,3-dione;tungsten(2+) |
SMILES | [CH-]1C=C[CH-]C2C1C(=O)OC2=O.[W+2] |
InchI Identifier | InChI=1S/C8H6O3.W/c9-7-5-3-1-2-4-6(5)8(10)11-7;/h1-6H;/q-2;+2 |
InchI Key | GGPCPXJTVGECBL-UHFFFAOYSA-N |
Safety information
UN | 3396 |
Hazardous class | 4.3(4.1) |
Packing group | III |
Pictograms | |
Signal word | DANGER |
Hazard statements | H228-H261-H315-H319-H335 |
Precautionary statements | P210-P223-P231 + P232-P240-P241-P261-P264-P271-P280-P302 + P352-P304 + P340-P305 + P351 + P338-P312-P334 + P335-P337 + P313-P362-P370 + P378 |
Transport description | Organometallic substance, solid, water-reactive, flammable (Cyclopentadienyltungs ten(II) tricarbonyl hydride) |
In TSCA registry | No (research and development usage only) |