CAS No. 1271-42-7
For more details check the specification page: Ferrocenecarboxylic acid
Chemical identifiers
Linear formula | C11H10FeO2 |
Pubchem CID | 499634 |
IUPAC Name | cyclopentane;cyclopentanecarboxylic acid;iron |
SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][C]([CH]1)C(=O)O.[Fe] |
InchI Identifier | InChI=1S/C6H5O2.C5H5.Fe/c7-6(8)5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H,(H,7,8);1-5H; |
InchI Key | VUJLGCHOGQEAED-UHFFFAOYSA-N |
Safety information
UN | Not regulated |
Hazardous class | Not regulated |
Packing group | Not regulated |
Pictograms | ![GHS07](/wp-content/uploads/2019/12/GHS07.jpg) |
Signal word | WARNING |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P264-P271-P280-P304 + P340 + P312-P302 + P352 + P362+P364-P332 + P313-P305 + P351 + P338-P337 + P313 |
Transport description | NONH for all modes of transport |
In TSCA registry | No (research and development usage only) |