CAS No. 1291-32-3
Bis(cyclopentadienyl)zirconium(IV) dichloride
For more details check the specification page:
Chemical identifiers
Linear formula | (C5H5)2ZrCl2 |
Pubchem CID | 10891641 |
IUPAC Name | cyclopentane;dichlorozirconium |
SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.Cl[Zr]Cl |
InchI Identifier | InChI=1S/2C5H5.2ClH.Zr/c2*1-2-4-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
InchI Key | QRUYYSPCOGSZGQ-UHFFFAOYSA-L |
Safety information
UN | Not regulated |
Hazardous class | Not regulated |
Packing group | Not regulated |
Pictograms | ![]() |
Signal word | WARNING |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P305 + P351 + P338 |
Transport description | NONH for all modes of transport |
In TSCA registry | Yes |