For more details check the specification page: Iron(II) acetylacetonate
| Linear formula | [CH3COCH=C(O)CH3]2Fe |
| Pubchem CID | 11482195 |
| SMILES | CC(=CC(=O)C)O.CC(=CC(=O)C)O.[Fe] |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one; iron |
| InchI Identifier | InChI=1S/2C5H8O2.Fe/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/b2*4-3-; |
| InchI Key | LFKXWKGYHQXRQA-FDGPNNRMSA-N |
| UN | Not regulated |
| Hazardous class | Not regulated |
| Packing group | Not regulated |
| Pictograms | |
| Signal word | WARNING |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340 |
| Transport description | Not dangerous goods |
| In TSCA registry | No (sold for research and development usage only) |