CAS No. 14040-05-2
For more details check the specification page: 2,2,6,6-Tetramethyl-3,5-heptanedionate(II)copper
Chemical identifiers
| Linear formula | Cu[OCC(CH3)3CHCOC(CH3)3]2 |
| Pubchem CID | 14534779 |
| SMILES | [Cu+2].[O-]\C(=C/C(=O)C(C)(C)C)C(C)(C)C.CC(C)(C)C(=O)/C=C(\[O-])C(C)(C)C |
| IUPAC Name | copper; (Z)-2,2,6,6-tetramethyl-5-oxohept-3-en-3-olate |
| InchI Identifier | InChI=1S/2C11H20O2.Cu/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;/h2*7,12H,1-6H3;/q;;+2/p-2/b2*8-7-; |
| InchI Key | VCIKJQZFNVXWPF-ATMONBRVSA-L |
Safety information
| UN | Not regulated |
| Hazardous class | Not regulated |
| Packing group | Not regulated |
| Pictograms |  |
| Signal word | WARNING |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280 |
| In TSCA registry | No (sold for research and development usage only) |
