CAS No. 177099-51-3
For more details check the specification page: Bis(N,N-di-tert-butyl-1,4-diaza-1,3-butadienyl)cobalt
Chemical identifiers
| Linear formula | C20H42N4Co |
| Pubchem CID | 131698366 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Sn+2] |
| IUPAC Name | cobalt;N,N’-ditert-butylethane-1,2-diimine |
| InchI Identifier | InChI=1S/2C10H20N2.Co/c2*1-9(2,3)11-7-8-12-10(4,5)6;/h2*7-8H,1-6H3; |
| InchI Key | CC(C)(C)N=CC=NC(C)(C)C.CC(C)(C)N=CC=NC(C)(C)C.[Co] |
Safety information
| UN | Not regulated |
| Hazardous class | Not regulated |
| Packing group | Not regulated |
| Pictograms |    |
| Signal word | DANGER |
| Hazard statements | H303-H317-H319-H334-H335-H351-H404-H411 |
| Precautionary statements | P201-P202-P261-P264-P271-P272-P273-P280-P281-P285 |
| In TSCA registry | No (sold for research and development usage only) |
