CAS No. 1799-90-2
For more details check the specification page: Bis(pentafluorophenyl)zinc
Chemical identifiers
| Linear formula | (C6F5)2Zn |
| Pubchem CID | 3495745 |
| IUPAC Name | zinc;1,2,3,4,5-pentafluorobenzene-6-ide |
| SMILES | [C-]1=C(C(=C(C(=C1F)F)F)F)F.[C-]1=C(C(=C(C(=C1F)F)F)F)F.[Zn+2] |
| InchI Identifier | InChI=1S/2C6F5.Zn/c2*7-2-1-3(8)5(10)6(11)4(2)9;/q2*-1;+2 |
| InchI Key | TURVSLXVJYZFII-UHFFFAOYSA-N |
Safety information
| UN | Not regulated |
| Hazardous class | Not regulated |
| Packing group | Not regulated |
| Pictograms | None |
| Signal word | None |
| Hazard statements | None |
| Precautionary statements | P264-P312-P501 |
| Transport description | NONH for all modes of transport |
| In TSCA registry | No (research and development usage only) |

