CAS No. 185827-91-2
For more details check the specification page: Bis(dimethylamino-2-propoxy)copper(II)
Chemical identifiers
| Linear formula | Cu(C5H12NO)2 |
| Pubchem CID | 121234236 |
| SMILES | CCC(N(C)C)[O-].CCC(N(C)C)[O-].[Cu+2] |
| IUPAC Name | copper; 1-(dimethylamino)propan-1-olate |
| InchI Identifier | InChI=1S/2C5H12NO.Cu/c2*1-4-5(7)6(2)3;/h2*5H,4H2,1-3H3;/q2*-1;+2 |
| InchI Key | AZOFWQDMTKZNMJ-UHFFFAOYSA-N |
Safety information
| UN | Not regulated |
| Hazardous class | Not applicable |
| Packing group | Not applicable |
| Pictograms |  |
| Signal word | WARNING |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P231-P222-P305+P351+P338-P403+P233-P422-P501 |
| Transport description | NONH for all modes of transport |
| In TSCA registry | No (sold for research and development usage only) |
