CAS No. 186598-40-3

For more details check the specification page: Bis(t-butylamino)silane

 

Chemical identifiers

Linear formula[NH(C4H9)]2SiH2
Pubchem CID57370846
SMILESCC(C)(C)N[SiH2]NC(C)(C)C
IUPAC NameN-(tert-butylamino)silyl-2-methylpropan-2-amine
InchI IdentifierInChI=1S/C8H22N2Si/c1-7(2,3)9-11-10-8(4,5)6/h9-10H,11H2,1-6H3
InchI KeyVYIRVGYSUZPNLF-UHFFFAOYSA-N

Safety information

UN2924
Hazardous class3(8)
Packing groupII
PictogramsGHS02GHS06GHS07
Signal wordDANGER
Hazard statementsH226-H260-H301-H314-H318-H332-H402-H412
Precautionary statementsP210-P223-P231 + P232-P233-P240-P241-P242-P243-P261-P264-P270-P271-P273-P280-P301 + P310-P301 + P330 + P331-P303 + P361 + P353-P304 + P340-P305 + P351 + P338-P310-P330-P334 + P335-P363-P370 + P378-P391
Transport descriptionFlammable liquid,corrosive n.o.s.(Bis(tert-butylamino) silane)
In TSCA registryNo (research and development only)