CAS No. 3094-87-9
For more details check the specification page: Iron(II) acetate
Chemical identifiers
Linear formula | Fe(CH3COO)2 |
Pubchem CID | 517325 |
SMILES | [Fe+2].[O-]C(=O)C.[O-]C(=O)C |
IUPAC Name | acetic acid; iron |
InchI Identifier | InChI=1S/2C2H4O2.Fe/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
InchI Key | LNOZJRCUHSPCDZ-UHFFFAOYSA-L |
Safety information
UN | Not regulated |
Hazardous class | Not regulated |
Packing group | Not regulated |
Pictograms | |
Signal word | WARNING |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P264-P271-P280-P302 + P352-P304 + P340-P305 + P351 + P338-P312-P332 + P313-P337 + P313-P362 |
Transport description | NONH for all modes of transport |
In TSCA registry | Yes |