CAS No. 32093-39-3
For more details check the specification page: Tris(dimethylamino)aluminum
Chemical identifiers
| Linear formula | Al(N(CH3)2) |
| Pubchem CID | 16688802 |
| SMILES | CN(C)[Al](N(C)C)N(C)C.CN(C)[Al](N(C)C)N(C)C |
| IUPAC Name | N-[bis(dimethylamino)alumanyl]-N-methylmethanamine |
| InchI Identifier | InChI=1S/6C2H6N.2Al/c6*1-3-2;;/h6*1-2H3;;/q6*-1;2*+3 |
| InchI Key | JGZUJELGSMSOID-UHFFFAOYSA-N |
Safety information
| UN | 3131 |
| Hazardous class | 4.3 |
| Packing group | I |
| Pictograms |   |
| Signal word | DANGER |
| Hazard statements | H260-H314-H318 |
| Precautionary statements | P223-P231+P232-P260-P264-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P321-P335+P334-P363-P370+P378-P402+P404-P405-P501 |
| Transport description | Water-reactive substances, solid, corrosive, n.o.s. (Tris(dimethylamino) aluminum) |
| In TSCA registry | No (sold for research and development usage only) |
