CAS No. 33636-93-0
For more details check the specification page: (Triphenylphosphine)copper hydride hexamer
Chemical identifiers
| Linear formula | [(C6H5)3PCuH]6 |
| Pubchem CID | 12181933 |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1) P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2) C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[Cu].[Cu].[Cu].[Cu].[Cu].[Cu] |
| IUPAC Name | copper monohydride; triphenylphosphane |
| InchI Identifier | InChI=1S/6C18H15P.6Cu.6H/c6*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;;;;;;/h6*1-15H;;;;;;;;;;;; |
| InchI Key | PYHLOCIDGQNZFY-UHFFFAOYSA-N |
Safety information
| UN | Not regulated |
| Hazardous class | Not applicable |
| Packing group | Not applicable |
| Pictograms |  |
| Signal word | WARNING |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301 + P312-P302 + P352-P304 + P340-P305 + P351 + P338-P312-P330-P332 + P313 |
| Transport description | NONH for all modes of transport |
| In TSCA registry | Yes |
