CAS No. 33636-93-0
(Triphenylphosphine)copper hydride hexamer
For more details check the specification page:
Chemical identifiers
Linear formula | [(C6H5)3PCuH]6 |
Pubchem CID | 12181933 |
SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)
P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2) C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[Cu].[Cu].[Cu].[Cu].[Cu].[Cu] |
IUPAC Name | copper monohydride; triphenylphosphane |
InchI Identifier | InChI=1S/6C18H15P.6Cu.6H/c6*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;;;;;;/h6*1-15H;;;;;;;;;;;; |
InchI Key | PYHLOCIDGQNZFY-UHFFFAOYSA-N |
Safety information
UN | Not regulated |
Hazardous class | Not applicable |
Packing group | Not applicable |
Pictograms | ![]() |
Signal word | WARNING |
Hazard statements | H302-H315-H319-H335 |
Precautionary statements | P261-P264-P270-P271-P280-P301 + P312-P302 + P352-P304 + P340-P305 + P351 + P338-P312-P330-P332 + P313 |
Transport description | NONH for all modes of transport |
In TSCA registry | Yes |