CAS No. 406462-43-9
Bis(tert-butylimino)bis(dimethylamino)tungsten(VI)
For more details check the specification page:
Chemical identifiers
Linear formula | ((CH3)3CN)2W(N(CH3)2)2 |
Pubchem CID | 16217328 |
SMILES | CC(C)(C)N=[W]=NC(C)(C)C.C[N-]C.C[N-]C |
IUPAC Name | bis(tert-butylimino)tungsten;dimethylazanide |
InchI Identifier | InChI=1S/2C4H9N.2C2H6N.W/c2*1-4(2,3)5;2*1-3-2;/h2*1-3H3;2*1-2H3;/q;;2*-1; |
InchI Key | JVCWKXBYGCJHDF-UHFFFAOYSA |
Safety information
UN | 3399 |
Hazardous class | 4.3(3) |
Packing group | I |
Pictograms | ![]() ![]() |
Signal word | DANGER |
Hazard statements | H225-H260-H314-H318 |
Precautionary statements | P210-P223-P231 + P232-P233-P240-P241-P242-P243-P260-P264-P280-P301 + P330 + P331-P303 + P361 + P353-P304 + P340-P305 + P351 + P338-P310-P334 + P335-P370 + P378-P402 + P404-P403 + P235-P405-P422-P501 |
Transport description | ORGANOMETALLIC SUBSTANCE, LIQUID, WATER-REACTIVE, FLAMMABLE (Bis(tert-butylimino) bis(dimethylamino) tungsten(VI)) |
In TSCA registry | No (sold for research and development usage only) |