For more details check the specification page: Pentamethylcyclopentadienylzirconium trichloride
Linear formula | C10H15Cl3Zr |
Pubchem CID | 90475860 |
IUPAC Name | 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;trichlorozirconium |
SMILES | CC1=C([C](C(=C1C)C)C)C.Cl[Zr](Cl)Cl |
InchI Identifier | InChI=1S/C10H15.3ClH.Zr/c1-6-7(2)9(4)10(5)8(6)3;;;;/h1-5H3;3*1H;/q;;;;+3/p-3 |
InchI Key | FOKGVHRHBBEPPI-UHFFFAOYSA-K |
UN | 3261 |
Hazardous class | 8 |
Packing group | II |
Pictograms | |
Signal word | WARNING |
Hazard statements | H315-H319-H335 |
Precautionary statements | P261-P264-P271-P280-P302 + P352-P304 + P340-P305 + P351 + P338-P312-P332 + P313-P337 + P313-P362 |
Transport description | Corrosive solid, acidic, organic, n.o.s. (Pentamethylcyclo- pentadienylzirconium (IV) trichloride) |
In TSCA registry | No (research and development usage only) |