CAS Number 942311-35-5
  For more details check the specification page: Nickel(II) 1-dimethylamino-2-methyl-2-butoxide
Chemical identifiers
| Linear formula | C14H32N2O2Ni | 
| Pubchem CID | 89558561 | 
| SMILES | CCC(C)(CN(C)C)[O-].CCC(C)(CN(C)C)[O-].[Ni+2] | 
| IUPAC Name | 1-(dimethylamino)-2-methylbutan-2-olate;nickel(2+) | 
| InchI Identifier | InChI=1S/2C7H16NO.Ni/c2*1-5-7(2,9)6-8(3)4;/h2*5-6H2,1-4H3;/q2*-1;+2 | 
| InchI Key | LECAMOYWYJUYIH-UHFFFAOYSA-N | 
Safety information
| Signal word | DANGER | 
| Pictograms | |
| Hazard statements | H315, H319, H334, H335, H372 | 
| Precautionary statements | P260, P261, P264, P270, P271, P280, P285, P302+P352, P304+P340, P304+P341, P305+P351+P338, P312, P314, P321, P332+P313, P337+P313, P342+P311, P362, P403+P233, P405, P501 | 
| UN | 3148 | 
| Transport description | WATER-REACTIVE LIQUID, N.O.S. (Nickel(II) 1- dimethylamino-2-methyl-2-butoxide) | 
| Hazardous class | 4.3 | 
| Packing group | II | 
| In TSCA registry | No (sold for research and development usage only) | 

 
 